C16H20N4O3S — CID 135976864
ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylsulfanyl]benzoate (PubChem CID 135976864) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylsulfanyl]benzoate.
| Compound Name | ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylsulfanyl]benzoate |
|---|---|
| PubChem CID | 135976864 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylsulfanyl]benzoate |
| SMILES | CCOC(=O)c1ccc(SCCCc2c(N)nc(N)[nH]c2=O)cc1 |
| InChI | InChI=1S/C16H20N4O3S/c1-2-23-15(22)10-5-7-11(8-6-10)24-9-3-4-12-13(17)19-16(18)20-14(12)21/h5-8H,2-4,9H2,1H3,(H5,17,18,19,20,21) |
| InChIKey | ZCTAXVAQTOGPQQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|