C16H15N5O3S — CID 136502411
methyl 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethylsulfanyl]benzoate (PubChem CID 136502411) has the molecular formula C16H15N5O3S and a molecular weight of 357.40 g/mol. Its IUPAC name is methyl 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethylsulfanyl]benzoate.
| Compound Name | methyl 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethylsulfanyl]benzoate |
|---|---|
| PubChem CID | 136502411 |
| Molecular Formula | C16H15N5O3S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | methyl 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethylsulfanyl]benzoate |
| SMILES | COC(=O)c1ccc(SCCc2cnc3nc(N)[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C16H15N5O3S/c1-24-15(23)9-2-4-11(5-3-9)25-7-6-10-8-18-13-12(19-10)14(22)21-16(17)20-13/h2-5,8H,6-7H2,1H3,(H3,17,18,20,21,22) |
| InChIKey | IAJHSXDOGPFPOQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |