C18H19N7O4 — CID 140645294
methyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]propanoate (PubChem CID 140645294) has the molecular formula C18H19N7O4 and a molecular weight of 397.40 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 140645294 |
| Molecular Formula | C18H19N7O4 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | methyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C18H19N7O4/c1-9(17(28)29-2)22-15(26)10-3-5-11(6-4-10)20-7-12-8-21-14-13(23-12)16(27)25-18(19)24-14/h3-6,8-9,20H,7H2,1-2H3,(H,22,26)(H3,19,21,24,25,27)/t9-/m0/s1 |
| InChIKey | QMHHJNVSNHUUKW-VIFPVBQESA-N |
| XLogP | 0.20 |
| TPSA | 164.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |