C22H29N7O3 — CID 144831525
4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-(5-oxohexan-2-yl)benzamide;ethane (PubChem CID 144831525) has the molecular formula C22H29N7O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-(5-oxohexan-2-yl)benzamide;ethane.
| Compound Name | 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-(5-oxohexan-2-yl)benzamide;ethane |
|---|---|
| PubChem CID | 144831525 |
| Molecular Formula | C22H29N7O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-(5-oxohexan-2-yl)benzamide;ethane |
| SMILES | CC.CC(=O)CCC(C)NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C20H23N7O3.C2H6/c1-11(3-4-12(2)28)24-18(29)13-5-7-14(8-6-13)22-9-15-10-23-17-16(25-15)19(30)27-20(21)26-17;1-2/h5-8,10-11,22H,3-4,9H2,1-2H3,(H,24,29)(H3,21,23,26,27,30);1-2H3 |
| InChIKey | LYIBAAUYPXZNPY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 155.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |