C19H21N7O4 — CID 135932484
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid (PubChem CID 135932484) has the molecular formula C19H21N7O4 and a molecular weight of 411.42 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 135932484 |
| Molecular Formula | C19H21N7O4 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C19H21N7O4/c1-2-3-13(18(29)30)24-16(27)10-4-6-11(7-5-10)21-8-12-9-22-15-14(23-12)17(28)26-19(20)25-15/h4-7,9,13,21H,2-3,8H2,1H3,(H,24,27)(H,29,30)(H3,20,22,25,26,28) |
| InChIKey | TZDLUIPHZFVEJS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 175.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |