C19H18N7O5Zr- — CID 175843245
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid;zirconium (PubChem CID 175843245) has the molecular formula C19H18N7O5Zr- and a molecular weight of 515.62 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid;zirconium.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid;zirconium |
|---|---|
| PubChem CID | 175843245 |
| Molecular Formula | C19H18N7O5Zr- |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid;zirconium |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)N[C@@H](CC[C-]=O)C(=O)O)cc3)nc2c(=O)[nH]1.[Zr] |
| InChI | InChI=1S/C19H18N7O5.Zr/c20-19-25-15-14(17(29)26-19)23-12(9-22-15)8-21-11-5-3-10(4-6-11)16(28)24-13(18(30)31)2-1-7-27;/h3-6,9,13,21H,1-2,8H2,(H,24,28)(H,30,31)(H3,20,22,25,26,29);/q-1;/t13-;/m0./s1 |
| InChIKey | FGEJLYBCHXERQH-ZOWNYOTGSA-N |
| XLogP | -0.02 |
| TPSA | 193.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|