C40H42N14O12 — CID 136932722
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-methylpentanedioic acid (PubChem CID 136932722) has the molecular formula C40H42N14O12 and a molecular weight of 910.86 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-methylpentanedioic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-methylpentanedioic acid |
|---|---|
| PubChem CID | 136932722 |
| Molecular Formula | C40H42N14O12 |
| Molecular Weight | 910.86 g/mol |
| Exact Mass | 910.31 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-methylpentanedioic acid |
| SMILES | CC(CC(NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O)C(=O)O.CC(CC(NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/2C20H21N7O6/c2*1-9(18(30)31)6-13(19(32)33)25-16(28)10-2-4-11(5-3-10)22-7-12-8-23-15-14(24-12)17(29)27-20(21)26-15/h2*2-5,8-9,13,22H,6-7H2,1H3,(H,25,28)(H,30,31)(H,32,33)(H3,21,23,26,27,29) |
| InChIKey | DZJNFNLLHKNMAL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 426.56 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.86 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 18 |