C19H18ClN7O6 — CID 136623160
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-chloropentanedioic acid (PubChem CID 136623160) has the molecular formula C19H18ClN7O6 and a molecular weight of 475.85 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-chloropentanedioic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-chloropentanedioic acid |
|---|---|
| PubChem CID | 136623160 |
| Molecular Formula | C19H18ClN7O6 |
| Molecular Weight | 475.85 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-chloropentanedioic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)NC(CC(Cl)C(=O)O)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H18ClN7O6/c20-11(17(30)31)5-12(18(32)33)25-15(28)8-1-3-9(4-2-8)22-6-10-7-23-14-13(24-10)16(29)27-19(21)26-14/h1-4,7,11-12,22H,5-6H2,(H,25,28)(H,30,31)(H,32,33)(H3,21,23,26,27,29) |
| InChIKey | IESCMAXBEMYTDA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 213.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.85 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|