C20H25N7O2S2 — CID 163843693
4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-[(2R)-1-(propyldisulfanyl)propan-2-yl]benzamide (PubChem CID 163843693) has the molecular formula C20H25N7O2S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-[(2R)-1-(propyldisulfanyl)propan-2-yl]benzamide.
| Compound Name | 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-[(2R)-1-(propyldisulfanyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 163843693 |
| Molecular Formula | C20H25N7O2S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-[(2R)-1-(propyldisulfanyl)propan-2-yl]benzamide |
| SMILES | CCCSSC[C@@H](C)NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C20H25N7O2S2/c1-3-8-30-31-11-12(2)24-18(28)13-4-6-14(7-5-13)22-9-15-10-23-17-16(25-15)19(29)27-20(21)26-17/h4-7,10,12,22H,3,8-9,11H2,1-2H3,(H,24,28)(H3,21,23,26,27,29)/t12-/m1/s1 |
| InChIKey | OOGFXIXBBMBJOE-GFCCVEGCSA-N |
| XLogP | 2.82 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|