C14H15N7O3 — CID 141323082
azanium 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoate (PubChem CID 141323082) has the molecular formula C14H15N7O3 and a molecular weight of 329.32 g/mol. Its IUPAC name is azanium 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoate.
| Compound Name | azanium 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 141323082 |
| Molecular Formula | C14H15N7O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | azanium 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoate |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)[O-])cc3)nc2c(=O)[nH]1.[NH4+] |
| InChI | InChI=1S/C14H12N6O3.H3N/c15-14-19-11-10(12(21)20-14)18-9(6-17-11)5-16-8-3-1-7(2-4-8)13(22)23;/h1-4,6,16H,5H2,(H,22,23)(H3,15,17,19,20,21);1H3 |
| InChIKey | JVWDOIZLCUXEBQ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 186.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |