C15H12N6O4 — CID 136660568
2-[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]phenyl]-2-oxoacetic acid (PubChem CID 136660568) has the molecular formula C15H12N6O4 and a molecular weight of 340.30 g/mol. Its IUPAC name is 2-[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]phenyl]-2-oxoacetic acid.
| Compound Name | 2-[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 136660568 |
| Molecular Formula | C15H12N6O4 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]phenyl]-2-oxoacetic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H12N6O4/c16-15-20-12-10(13(23)21-15)19-9(6-18-12)5-17-8-3-1-7(2-4-8)11(22)14(24)25/h1-4,6,17H,5H2,(H,24,25)(H3,16,18,20,21,23) |
| InChIKey | HHXGRIVDHWUGHK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 163.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|