C19H17N7O6 — CID 174274363
2-[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]iminopentanedioic acid (PubChem CID 174274363) has the molecular formula C19H17N7O6 and a molecular weight of 439.39 g/mol. Its IUPAC name is 2-[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]iminopentanedioic acid.
| Compound Name | 2-[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]iminopentanedioic acid |
|---|---|
| PubChem CID | 174274363 |
| Molecular Formula | C19H17N7O6 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]iminopentanedioic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)/N=C(\CCC(=O)O)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H17N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,21H,5-7H2,(H,27,28)(H,31,32)(H3,20,22,25,26,30)/b24-12+ |
| InChIKey | DPIFOLOGBLSGER-WYMPLXKRSA-N |
| XLogP | 0.44 |
| TPSA | 213.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|