C19H19N7O5 — CID 135723200
4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid (PubChem CID 135723200) has the molecular formula C19H19N7O5 and a molecular weight of 425.41 g/mol. Its IUPAC name is 4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 135723200 |
| Molecular Formula | C19H19N7O5 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)NC(C=O)CCC(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H19N7O5/c20-19-25-16-15(18(31)26-19)23-13(8-22-16)7-21-11-3-1-10(2-4-11)17(30)24-12(9-27)5-6-14(28)29/h1-4,8-9,12,21H,5-7H2,(H,24,30)(H,28,29)(H3,20,22,25,26,31) |
| InChIKey | ZTWOXLOHOPWZFM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 193.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|