C20H24N8O3 — CID 136598445
N-[(2S)-6-amino-1-oxohexan-2-yl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide (PubChem CID 136598445) has the molecular formula C20H24N8O3 and a molecular weight of 424.47 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-oxohexan-2-yl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide.
| Compound Name | N-[(2S)-6-amino-1-oxohexan-2-yl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 136598445 |
| Molecular Formula | C20H24N8O3 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[(2S)-6-amino-1-oxohexan-2-yl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide |
| SMILES | NCCCC[C@@H](C=O)NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C20H24N8O3/c21-8-2-1-3-14(11-29)26-18(30)12-4-6-13(7-5-12)23-9-15-10-24-17-16(25-15)19(31)28-20(22)27-17/h4-7,10-11,14,23H,1-3,8-9,21H2,(H,26,30)(H3,22,24,27,28,31)/t14-/m0/s1 |
| InChIKey | XNESGOCJQQCVIJ-AWEZNQCLSA-N |
| XLogP | 0.33 |
| TPSA | 181.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|