C25H32N8O6 — CID 139935712
(2S)-5-(6-aminohexoxy)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid (PubChem CID 139935712) has the molecular formula C25H32N8O6 and a molecular weight of 540.58 g/mol. Its IUPAC name is (2S)-5-(6-aminohexoxy)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-(6-aminohexoxy)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 139935712 |
| Molecular Formula | C25H32N8O6 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | (2S)-5-(6-aminohexoxy)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCCCOC(=O)CC[C@H](NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C25H32N8O6/c26-11-3-1-2-4-12-39-19(34)10-9-18(24(37)38)31-22(35)15-5-7-16(8-6-15)28-13-17-14-29-21-20(30-17)23(36)33-25(27)32-21/h5-8,14,18,28H,1-4,9-13,26H2,(H,31,35)(H,37,38)(H3,27,29,32,33,36)/t18-/m0/s1 |
| InChIKey | FRJTUJJKHFULQT-SFHVURJKSA-N |
| XLogP | 0.93 |
| TPSA | 228.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|