C25H27N7O8 — CID 137168440
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxopentanoic acid (PubChem CID 137168440) has the molecular formula C25H27N7O8 and a molecular weight of 553.53 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxopentanoic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 137168440 |
| Molecular Formula | C25H27N7O8 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxopentanoic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC(NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C25H27N7O8/c1-13(2)24(38)40-10-9-39-18(33)8-7-17(23(36)37)30-21(34)14-3-5-15(6-4-14)27-11-16-12-28-20-19(29-16)22(35)32-25(26)31-20/h3-6,12,17,27H,1,7-11H2,2H3,(H,30,34)(H,36,37)(H3,26,28,31,32,35) |
| InChIKey | XIEIDTWEGHBLJF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 228.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|