C27H33N7O7 — CID 174796756
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-octanoyloxy-5-oxopentanoic acid (PubChem CID 174796756) has the molecular formula C27H33N7O7 and a molecular weight of 567.60 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-octanoyloxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-octanoyloxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174796756 |
| Molecular Formula | C27H33N7O7 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-octanoyloxy-5-oxopentanoic acid |
| SMILES | CCCCCCCC(=O)OC(=O)CC[C@H](NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C27H33N7O7/c1-2-3-4-5-6-7-20(35)41-21(36)13-12-19(26(39)40)32-24(37)16-8-10-17(11-9-16)29-14-18-15-30-23-22(31-18)25(38)34-27(28)33-23/h8-11,15,19,29H,2-7,12-14H2,1H3,(H,32,37)(H,39,40)(H3,28,30,33,34,38)/t19-/m0/s1 |
| InChIKey | KFXGPGQZHIJAMD-IBGZPJMESA-N |
| XLogP | 2.30 |
| TPSA | 219.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|