C29H35N7O6 — CID 138559818
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid (PubChem CID 138559818) has the molecular formula C29H35N7O6 and a molecular weight of 577.64 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 138559818 |
| Molecular Formula | C29H35N7O6 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)CCC(NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C29H35N7O6/c1-17(2)5-4-6-18(3)13-14-42-23(37)12-11-22(28(40)41)34-26(38)19-7-9-20(10-8-19)31-15-21-16-32-25-24(33-21)27(39)36-29(30)35-25/h5,7-10,13,16,22,31H,4,6,11-12,14-15H2,1-3H3,(H,34,38)(H,40,41)(H3,30,32,35,36,39)/b18-13+ |
| InChIKey | VVCDRXYTKPDDJQ-QGOAFFKASA-N |
| XLogP | 3.11 |
| TPSA | 202.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|