C30H42N8O8 — CID 135967069
(2R)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-9-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]-5-oxononanoic acid (PubChem CID 135967069) has the molecular formula C30H42N8O8 and a molecular weight of 642.71 g/mol. Its IUPAC name is (2R)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-9-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]-5-oxononanoic acid.
| Compound Name | (2R)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-9-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]-5-oxononanoic acid |
|---|---|
| PubChem CID | 135967069 |
| Molecular Formula | C30H42N8O8 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | (2R)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-9-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]-5-oxononanoic acid |
| SMILES | NCCCOCCOCCOCCCCC(=O)CC[C@@H](NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C30H42N8O8/c31-11-3-13-45-15-17-46-16-14-44-12-2-1-4-23(39)9-10-24(29(42)43)36-27(40)20-5-7-21(8-6-20)33-18-22-19-34-26-25(35-22)28(41)38-30(32)37-26/h5-8,19,24,33H,1-4,9-18,31H2,(H,36,40)(H,42,43)(H3,32,34,37,38,41)/t24-/m1/s1 |
| InChIKey | PVRDKDREQYWIMM-XMMPIXPASA-N |
| XLogP | 1.01 |
| TPSA | 246.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|