C39H50N8O9 — CID 158403947
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-8-[2-(6-benzamido-3-oxohexoxy)ethoxy]-5-oxooctanoic acid;ethane (PubChem CID 158403947) has the molecular formula C39H50N8O9 and a molecular weight of 774.88 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-8-[2-(6-benzamido-3-oxohexoxy)ethoxy]-5-oxooctanoic acid;ethane.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-8-[2-(6-benzamido-3-oxohexoxy)ethoxy]-5-oxooctanoic acid;ethane |
|---|---|
| PubChem CID | 158403947 |
| Molecular Formula | C39H50N8O9 |
| Molecular Weight | 774.88 g/mol |
| Exact Mass | 774.37 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-8-[2-(6-benzamido-3-oxohexoxy)ethoxy]-5-oxooctanoic acid;ethane |
| SMILES | CC.Nc1nc2ncc(CNc3ccc(C(=O)NC(CCC(=O)CCCOCCOCCC(=O)CCCNC(=O)c4ccccc4)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C37H44N8O9.C2H6/c38-37-44-32-31(35(50)45-37)42-27(23-41-32)22-40-26-12-10-25(11-13-26)34(49)43-30(36(51)52)15-14-28(46)9-5-18-53-20-21-54-19-16-29(47)8-4-17-39-33(48)24-6-2-1-3-7-24;1-2/h1-3,6-7,10-13,23,30,40H,4-5,8-9,14-22H2,(H,39,48)(H,43,49)(H,51,52)(H3,38,41,44,45,50);1-2H3 |
| InChIKey | GYLDNWCAZQKXES-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 257.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.88 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|