C35H47N7O11 — CID 138644266
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-8-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]octanoic acid (PubChem CID 138644266) has the molecular formula C35H47N7O11 and a molecular weight of 741.80 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-8-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]octanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-8-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]octanoic acid |
|---|---|
| PubChem CID | 138644266 |
| Molecular Formula | C35H47N7O11 |
| Molecular Weight | 741.80 g/mol |
| Exact Mass | 741.33 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-8-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]octanoic acid |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCCC(=O)CC[C@H](NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C35H47N7O11/c1-2-11-48-13-15-50-17-19-52-21-22-53-20-18-51-16-14-49-12-3-4-28(43)9-10-29(34(46)47)40-32(44)25-5-7-26(8-6-25)37-23-27-24-38-31-30(39-27)33(45)42-35(36)41-31/h1,5-8,24,29,37H,3-4,9-23H2,(H,40,44)(H,46,47)(H3,36,38,41,42,45)/t29-/m0/s1 |
| InChIKey | YBZIGYAYAWXCLO-LJAQVGFWSA-N |
| XLogP | 0.95 |
| TPSA | 248.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.80 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|