C24H30N8O7 — CID 136614430
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoic acid (PubChem CID 136614430) has the molecular formula C24H30N8O7 and a molecular weight of 542.55 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 136614430 |
| Molecular Formula | C24H30N8O7 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoic acid |
| SMILES | COCCOCCNC(=O)CCC(NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C24H30N8O7/c1-38-10-11-39-9-8-26-18(33)7-6-17(23(36)37)30-21(34)14-2-4-15(5-3-14)27-12-16-13-28-20-19(29-16)22(35)32-24(25)31-20/h2-5,13,17,27H,6-12H2,1H3,(H,26,33)(H,30,34)(H,36,37)(H3,25,28,31,32,35) |
| InChIKey | KQHPEYLRHJWJKQ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 223.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|