C27H37N9O8 — CID 136930541
5-[2-[2-(1-amino-2-ethoxyethoxy)ethoxy]ethylamino]-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid (PubChem CID 136930541) has the molecular formula C27H37N9O8 and a molecular weight of 615.65 g/mol. Its IUPAC name is 5-[2-[2-(1-amino-2-ethoxyethoxy)ethoxy]ethylamino]-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[2-[2-(1-amino-2-ethoxyethoxy)ethoxy]ethylamino]-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 136930541 |
| Molecular Formula | C27H37N9O8 |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | 5-[2-[2-(1-amino-2-ethoxyethoxy)ethoxy]ethylamino]-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxopentanoic acid |
| SMILES | CCOCC(N)OCCOCCNC(=O)CCC(NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C27H37N9O8/c1-2-42-15-20(28)44-12-11-43-10-9-30-21(37)8-7-19(26(40)41)34-24(38)16-3-5-17(6-4-16)31-13-18-14-32-23-22(33-18)25(39)36-27(29)35-23/h3-6,14,19-20,31H,2,7-13,15,28H2,1H3,(H,30,37)(H,34,38)(H,40,41)(H3,29,32,35,36,39) |
| InChIKey | ZOUSBBCGRBGMOA-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 258.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|