C21H24N8O5S — CID 136727778
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-(2-sulfanylethylamino)pentanoic acid (PubChem CID 136727778) has the molecular formula C21H24N8O5S and a molecular weight of 500.54 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-(2-sulfanylethylamino)pentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-(2-sulfanylethylamino)pentanoic acid |
|---|---|
| PubChem CID | 136727778 |
| Molecular Formula | C21H24N8O5S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-(2-sulfanylethylamino)pentanoic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)N[C@@H](CCC(=O)NCCS)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H24N8O5S/c22-21-28-17-16(19(32)29-21)26-13(10-25-17)9-24-12-3-1-11(2-4-12)18(31)27-14(20(33)34)5-6-15(30)23-7-8-35/h1-4,10,14,24,35H,5-9H2,(H,23,30)(H,27,31)(H,33,34)(H3,22,25,28,29,32)/t14-/m0/s1 |
| InChIKey | OQPOZRPSSKDVCO-AWEZNQCLSA-N |
| XLogP | -0.08 |
| TPSA | 205.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|