C24H28N8O8 — CID 164577531
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-carboxyethoxy)ethylamino]-5-oxopentanoic acid (PubChem CID 164577531) has the molecular formula C24H28N8O8 and a molecular weight of 556.54 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-carboxyethoxy)ethylamino]-5-oxopentanoic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-carboxyethoxy)ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 164577531 |
| Molecular Formula | C24H28N8O8 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(2-carboxyethoxy)ethylamino]-5-oxopentanoic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)NC(CCC(=O)NCCOCCC(=O)O)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H28N8O8/c25-24-31-20-19(22(37)32-24)29-15(12-28-20)11-27-14-3-1-13(2-4-14)21(36)30-16(23(38)39)5-6-17(33)26-8-10-40-9-7-18(34)35/h1-4,12,16,27H,5-11H2,(H,26,33)(H,30,36)(H,34,35)(H,38,39)(H3,25,28,31,32,37) |
| InChIKey | JDVVJMLTHUZVES-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 251.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|