C24H29N9O6S — CID 155545708
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-[2-(3-sulfanylpropanoylamino)ethylamino]pentanoic acid (PubChem CID 155545708) has the molecular formula C24H29N9O6S and a molecular weight of 571.62 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-[2-(3-sulfanylpropanoylamino)ethylamino]pentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-[2-(3-sulfanylpropanoylamino)ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 155545708 |
| Molecular Formula | C24H29N9O6S |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-[2-(3-sulfanylpropanoylamino)ethylamino]pentanoic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)N[C@@H](CCC(=O)NCCNC(=O)CCS)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H29N9O6S/c25-24-32-20-19(22(37)33-24)30-15(12-29-20)11-28-14-3-1-13(2-4-14)21(36)31-16(23(38)39)5-6-17(34)26-8-9-27-18(35)7-10-40/h1-4,12,16,28,40H,5-11H2,(H,26,34)(H,27,35)(H,31,36)(H,38,39)(H3,25,29,32,33,37)/t16-/m0/s1 |
| InChIKey | WKWVWVMRZYQOFF-INIZCTEOSA-N |
| XLogP | -0.58 |
| TPSA | 234.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|