C26H34N9O11P — CID 135991535
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[2-[ethoxy(hydroxy)phosphoryl]oxyethylcarbamoyloxy]ethylamino]-5-oxopentanoic acid (PubChem CID 135991535) has the molecular formula C26H34N9O11P and a molecular weight of 679.58 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[2-[ethoxy(hydroxy)phosphoryl]oxyethylcarbamoyloxy]ethylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[2-[ethoxy(hydroxy)phosphoryl]oxyethylcarbamoyloxy]ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 135991535 |
| Molecular Formula | C26H34N9O11P |
| Molecular Weight | 679.58 g/mol |
| Exact Mass | 679.21 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[2-[ethoxy(hydroxy)phosphoryl]oxyethylcarbamoyloxy]ethylamino]-5-oxopentanoic acid |
| SMILES | CCOP(=O)(O)OCCNC(=O)OCCNC(=O)CC[C@H](NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C26H34N9O11P/c1-2-45-47(42,43)46-12-10-29-26(41)44-11-9-28-19(36)8-7-18(24(39)40)33-22(37)15-3-5-16(6-4-15)30-13-17-14-31-21-20(32-17)23(38)35-25(27)34-21/h3-6,14,18,30H,2,7-13H2,1H3,(H,28,36)(H,29,41)(H,33,37)(H,39,40)(H,42,43)(H3,27,31,34,35,38)/t18-/m0/s1 |
| InChIKey | DYZNWINJXUOMSS-SFHVURJKSA-N |
| XLogP | -0.13 |
| TPSA | 299.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.58 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|