C30H38N10O10 — CID 137150622
6-amino-2-[[4-[[4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 137150622) has the molecular formula C30H38N10O10 and a molecular weight of 698.69 g/mol. Its IUPAC name is 6-amino-2-[[4-[[4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[4-[[4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 137150622 |
| Molecular Formula | C30H38N10O10 |
| Molecular Weight | 698.69 g/mol |
| Exact Mass | 698.28 |
| IUPAC Name | 6-amino-2-[[4-[[4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)CCC(NC(=O)CCC(NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C30H38N10O10/c31-12-2-1-3-18(27(45)46)36-21(41)10-8-19(28(47)48)37-22(42)11-9-20(29(49)50)38-25(43)15-4-6-16(7-5-15)33-13-17-14-34-24-23(35-17)26(44)40-30(32)39-24/h4-7,14,18-20,33H,1-3,8-13,31H2,(H,36,41)(H,37,42)(H,38,43)(H,45,46)(H,47,48)(H,49,50)(H3,32,34,39,40,44) |
| InChIKey | XDGGFTNZNWWEAE-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 334.80 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.69 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|