C16H18N8O2 — CID 166074874
N-(2-aminoethyl)-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide (PubChem CID 166074874) has the molecular formula C16H18N8O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide.
| Compound Name | N-(2-aminoethyl)-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 166074874 |
| Molecular Formula | C16H18N8O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-(2-aminoethyl)-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide |
| SMILES | NCCNC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C16H18N8O2/c17-5-6-19-14(25)9-1-3-10(4-2-9)20-7-11-8-21-13-12(22-11)15(26)24-16(18)23-13/h1-4,8,20H,5-7,17H2,(H,19,25)(H3,18,21,23,24,26) |
| InChIKey | FQAVZGULVVGQAX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 164.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |