C24H33N9O5 — CID 144728169
N-[4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-oxobutyl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide (PubChem CID 144728169) has the molecular formula C24H33N9O5 and a molecular weight of 527.59 g/mol. Its IUPAC name is N-[4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-oxobutyl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide.
| Compound Name | N-[4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-oxobutyl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 144728169 |
| Molecular Formula | C24H33N9O5 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | N-[4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-oxobutyl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide |
| SMILES | NCCOCCOCCNC(=O)CCCNC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C24H33N9O5/c25-7-10-37-12-13-38-11-9-27-19(34)2-1-8-28-22(35)16-3-5-17(6-4-16)29-14-18-15-30-21-20(31-18)23(36)33-24(26)32-21/h3-6,15,29H,1-2,7-14,25H2,(H,27,34)(H,28,35)(H3,26,30,32,33,36) |
| InChIKey | FYSAZZAHTIVZNS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 212.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|