C22H28N8O2S — CID 143669581
4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-[4-(1-sulfanylpropan-2-ylamino)pent-4-enyl]benzamide (PubChem CID 143669581) has the molecular formula C22H28N8O2S and a molecular weight of 468.59 g/mol. Its IUPAC name is 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-[4-(1-sulfanylpropan-2-ylamino)pent-4-enyl]benzamide.
| Compound Name | 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-[4-(1-sulfanylpropan-2-ylamino)pent-4-enyl]benzamide |
|---|---|
| PubChem CID | 143669581 |
| Molecular Formula | C22H28N8O2S |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-N-[4-(1-sulfanylpropan-2-ylamino)pent-4-enyl]benzamide |
| SMILES | C=C(CCCNC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)NC(C)CS |
| InChI | InChI=1S/C22H28N8O2S/c1-13(27-14(2)12-33)4-3-9-24-20(31)15-5-7-16(8-6-15)25-10-17-11-26-19-18(28-17)21(32)30-22(23)29-19/h5-8,11,14,25,27,33H,1,3-4,9-10,12H2,2H3,(H,24,31)(H3,23,26,29,30,32) |
| InChIKey | GXRKHPHDBBYAJC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|