C14H13N7O2 — CID 137013245
4-[(2-amino-4-oxo-3H-pteridin-7-yl)methylamino]benzamide (PubChem CID 137013245) has the molecular formula C14H13N7O2 and a molecular weight of 311.31 g/mol. Its IUPAC name is 4-[(2-amino-4-oxo-3H-pteridin-7-yl)methylamino]benzamide.
| Compound Name | 4-[(2-amino-4-oxo-3H-pteridin-7-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 137013245 |
| Molecular Formula | C14H13N7O2 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-[(2-amino-4-oxo-3H-pteridin-7-yl)methylamino]benzamide |
| SMILES | NC(=O)c1ccc(NCc2cnc3c(=O)[nH]c(N)nc3n2)cc1 |
| InChI | InChI=1S/C14H13N7O2/c15-11(22)7-1-3-8(4-2-7)17-5-9-6-18-10-12(19-9)20-14(16)21-13(10)23/h1-4,6,17H,5H2,(H2,15,22)(H3,16,19,20,21,23) |
| InChIKey | VYKYXTMTZSIGRV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 152.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |