C13H17N5O3 — CID 158588014
6-(2-amino-4-oxo-3H-pteridin-6-yl)-3-methylhexanoic acid (PubChem CID 158588014) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 6-(2-amino-4-oxo-3H-pteridin-6-yl)-3-methylhexanoic acid.
| Compound Name | 6-(2-amino-4-oxo-3H-pteridin-6-yl)-3-methylhexanoic acid |
|---|---|
| PubChem CID | 158588014 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 6-(2-amino-4-oxo-3H-pteridin-6-yl)-3-methylhexanoic acid |
| SMILES | CC(CCCc1cnc2nc(N)[nH]c(=O)c2n1)CC(=O)O |
| InChI | InChI=1S/C13H17N5O3/c1-7(5-9(19)20)3-2-4-8-6-15-11-10(16-8)12(21)18-13(14)17-11/h6-7H,2-5H2,1H3,(H,19,20)(H3,14,15,17,18,21) |
| InChIKey | KXCPPVAHBWNSTA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |