C20H21N7O6 — CID 135415773
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid (PubChem CID 135415773) has the molecular formula C20H21N7O6 and a molecular weight of 455.43 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 135415773 |
| Molecular Formula | C20H21N7O6 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid |
| SMILES | CN(Cc1cnc2nc(N)[nH]c(=O)c2n1)c1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H21N7O6/c1-27(9-11-8-22-16-15(23-11)18(31)26-20(21)25-16)12-4-2-10(3-5-12)17(30)24-13(19(32)33)6-7-14(28)29/h2-5,8,13H,6-7,9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H3,21,22,25,26,31) |
| InChIKey | HLIXOCXUWGDBNP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 204.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |