C25H33N9O6 — CID 175276756
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(1,6-diaminohexyl)amino]benzoyl]amino]pentanedioic acid (PubChem CID 175276756) has the molecular formula C25H33N9O6 and a molecular weight of 555.60 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(1,6-diaminohexyl)amino]benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(1,6-diaminohexyl)amino]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 175276756 |
| Molecular Formula | C25H33N9O6 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(1,6-diaminohexyl)amino]benzoyl]amino]pentanedioic acid |
| SMILES | NCCCCCC(N)N(Cc1cnc2nc(N)[nH]c(=O)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C25H33N9O6/c26-11-3-1-2-4-18(27)34(13-15-12-29-21-20(30-15)23(38)33-25(28)32-21)16-7-5-14(6-8-16)22(37)31-17(24(39)40)9-10-19(35)36/h5-8,12,17-18H,1-4,9-11,13,26-27H2,(H,31,37)(H,35,36)(H,39,40)(H3,28,29,32,33,38)/t17-,18?/m0/s1 |
| InChIKey | GGCLTZCSLQMNMU-ZENAZSQFSA-N |
| XLogP | 0.15 |
| TPSA | 256.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|