C22H22ClN7O7 — CID 135399073
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(3-chloropropanoyl)amino]benzoyl]amino]pentanedioic acid (PubChem CID 135399073) has the molecular formula C22H22ClN7O7 and a molecular weight of 531.91 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(3-chloropropanoyl)amino]benzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(3-chloropropanoyl)amino]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 135399073 |
| Molecular Formula | C22H22ClN7O7 |
| Molecular Weight | 531.91 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(3-chloropropanoyl)amino]benzoyl]amino]pentanedioic acid |
| SMILES | Nc1nc2ncc(CN(C(=O)CCCl)c3ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C22H22ClN7O7/c23-8-7-15(31)30(10-12-9-25-18-17(26-12)20(35)29-22(24)28-18)13-3-1-11(2-4-13)19(34)27-14(21(36)37)5-6-16(32)33/h1-4,9,14H,5-8,10H2,(H,27,34)(H,32,33)(H,36,37)(H3,24,25,28,29,35) |
| InChIKey | KXHXDEANXJEBOC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 221.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.91 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|