C20H22ClN7O5S — CID 54606976
2-[[4-[(2-amino-4-sulfanylidene-1H-pteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid;hydrochloride (PubChem CID 54606976) has the molecular formula C20H22ClN7O5S and a molecular weight of 507.96 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-sulfanylidene-1H-pteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid;hydrochloride.
| Compound Name | 2-[[4-[(2-amino-4-sulfanylidene-1H-pteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid;hydrochloride |
|---|---|
| PubChem CID | 54606976 |
| Molecular Formula | C20H22ClN7O5S |
| Molecular Weight | 507.96 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 2-[[4-[(2-amino-4-sulfanylidene-1H-pteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid;hydrochloride |
| SMILES | CN(Cc1cnc2[nH]c(N)nc(=S)c2n1)c1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1.Cl |
| InChI | InChI=1S/C20H21N7O5S.ClH/c1-27(9-11-8-22-16-15(23-11)18(33)26-20(21)25-16)12-4-2-10(3-5-12)17(30)24-13(19(31)32)6-7-14(28)29;/h2-5,8,13H,6-7,9H2,1H3,(H,24,30)(H,28,29)(H,31,32)(H3,21,22,25,26,33);1H |
| InChIKey | UFCYFGIPXBRYHV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 187.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.96 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|