C9H12N6O2 — CID 163537979
2-amino-6-[(1-hydroxyethylamino)methyl]-3H-pteridin-4-one (PubChem CID 163537979) has the molecular formula C9H12N6O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-amino-6-[(1-hydroxyethylamino)methyl]-3H-pteridin-4-one.
| Compound Name | 2-amino-6-[(1-hydroxyethylamino)methyl]-3H-pteridin-4-one |
|---|---|
| PubChem CID | 163537979 |
| Molecular Formula | C9H12N6O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-amino-6-[(1-hydroxyethylamino)methyl]-3H-pteridin-4-one |
| SMILES | CC(O)NCc1cnc2nc(N)[nH]c(=O)c2n1 |
| InChI | InChI=1S/C9H12N6O2/c1-4(16)11-2-5-3-12-7-6(13-5)8(17)15-9(10)14-7/h3-4,11,16H,2H2,1H3,(H3,10,12,14,15,17) |
| InChIKey | DYQIWDXIKLKGIH-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|