C9H11N5O4 — CID 135408877
2-amino-6-(1,2,3-trihydroxypropyl)-3H-pteridin-4-one (PubChem CID 135408877) has the molecular formula C9H11N5O4 and a molecular weight of 253.22 g/mol. Its IUPAC name is 2-amino-6-(1,2,3-trihydroxypropyl)-3H-pteridin-4-one.
| Compound Name | 2-amino-6-(1,2,3-trihydroxypropyl)-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135408877 |
| Molecular Formula | C9H11N5O4 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-amino-6-(1,2,3-trihydroxypropyl)-3H-pteridin-4-one |
| SMILES | Nc1nc2ncc(C(O)C(O)CO)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C9H11N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h1,4,6,15-17H,2H2,(H3,10,11,13,14,18) |
| InChIKey | BMQYVXCPAOLZOK-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |