C9H10N4O4 — CID 136646470
6-[(1R,2S)-1,2,3-trihydroxypropyl]-3H-pteridin-4-one (PubChem CID 136646470) has the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. Its IUPAC name is 6-[(1R,2S)-1,2,3-trihydroxypropyl]-3H-pteridin-4-one.
| Compound Name | 6-[(1R,2S)-1,2,3-trihydroxypropyl]-3H-pteridin-4-one |
|---|---|
| PubChem CID | 136646470 |
| Molecular Formula | C9H10N4O4 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 6-[(1R,2S)-1,2,3-trihydroxypropyl]-3H-pteridin-4-one |
| SMILES | O=c1[nH]cnc2ncc([C@@H](O)[C@@H](O)CO)nc12 |
| InChI | InChI=1S/C9H10N4O4/c14-2-5(15)7(16)4-1-10-8-6(13-4)9(17)12-3-11-8/h1,3,5,7,14-16H,2H2,(H,10,11,12,17)/t5-,7+/m0/s1 |
| InChIKey | DQXMSQZOIONGDB-CAHLUQPWSA-N |
| XLogP | -1.90 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |