C10H12N4O4S — CID 135838784
2-methylsulfanyl-6-[(1S,2S)-1,2,3-trihydroxypropyl]-3H-pteridin-4-one (PubChem CID 135838784) has the molecular formula C10H12N4O4S and a molecular weight of 284.30 g/mol. Its IUPAC name is 2-methylsulfanyl-6-[(1S,2S)-1,2,3-trihydroxypropyl]-3H-pteridin-4-one.
| Compound Name | 2-methylsulfanyl-6-[(1S,2S)-1,2,3-trihydroxypropyl]-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135838784 |
| Molecular Formula | C10H12N4O4S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-methylsulfanyl-6-[(1S,2S)-1,2,3-trihydroxypropyl]-3H-pteridin-4-one |
| SMILES | CSc1nc2ncc([C@H](O)[C@@H](O)CO)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N4O4S/c1-19-10-13-8-6(9(18)14-10)12-4(2-11-8)7(17)5(16)3-15/h2,5,7,15-17H,3H2,1H3,(H,11,13,14,18)/t5-,7-/m0/s1 |
| InChIKey | YMFRSBUBUSEASS-FSPLSTOPSA-N |
| XLogP | -1.18 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |