C18H27N5O8 — CID 137246677
2-amino-6-[(1R,2S)-1-hydroxy-2-[(2R,3R,4R,5S,6S)-6-(hydroxymethyl)-3,4,5-trimethoxyoxan-2-yl]oxypropyl]-3H-pteridin-4-one (PubChem CID 137246677) has the molecular formula C18H27N5O8 and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-amino-6-[(1R,2S)-1-hydroxy-2-[(2R,3R,4R,5S,6S)-6-(hydroxymethyl)-3,4,5-trimethoxyoxan-2-yl]oxypropyl]-3H-pteridin-4-one.
| Compound Name | 2-amino-6-[(1R,2S)-1-hydroxy-2-[(2R,3R,4R,5S,6S)-6-(hydroxymethyl)-3,4,5-trimethoxyoxan-2-yl]oxypropyl]-3H-pteridin-4-one |
|---|---|
| PubChem CID | 137246677 |
| Molecular Formula | C18H27N5O8 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-amino-6-[(1R,2S)-1-hydroxy-2-[(2R,3R,4R,5S,6S)-6-(hydroxymethyl)-3,4,5-trimethoxyoxan-2-yl]oxypropyl]-3H-pteridin-4-one |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](CO)O[C@@H](O[C@@H](C)[C@H](O)c2cnc3nc(N)[nH]c(=O)c3n2)[C@@H]1OC |
| InChI | InChI=1S/C18H27N5O8/c1-7(11(25)8-5-20-15-10(21-8)16(26)23-18(19)22-15)30-17-14(29-4)13(28-3)12(27-2)9(6-24)31-17/h5,7,9,11-14,17,24-25H,6H2,1-4H3,(H3,19,20,22,23,26)/t7-,9-,11-,12-,13+,14+,17+/m0/s1 |
| InChIKey | DGKUISNXCLDEPS-GFVKFAMKSA-N |
| XLogP | -1.50 |
| TPSA | 184.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |