C9H11N5O9S2 — CID 162659425
[(1R,2S)-1-(2-amino-4-oxo-3H-pteridin-6-yl)-1-sulfooxypropan-2-yl] hydrogen sulfate (PubChem CID 162659425) has the molecular formula C9H11N5O9S2 and a molecular weight of 397.35 g/mol. Its IUPAC name is [(1R,2S)-1-(2-amino-4-oxo-3H-pteridin-6-yl)-1-sulfooxypropan-2-yl] hydrogen sulfate.
| Compound Name | [(1R,2S)-1-(2-amino-4-oxo-3H-pteridin-6-yl)-1-sulfooxypropan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 162659425 |
| Molecular Formula | C9H11N5O9S2 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | [(1R,2S)-1-(2-amino-4-oxo-3H-pteridin-6-yl)-1-sulfooxypropan-2-yl] hydrogen sulfate |
| SMILES | C[C@H](OS(=O)(=O)O)[C@H](OS(=O)(=O)O)c1cnc2nc(N)[nH]c(=O)c2n1 |
| InChI | InChI=1S/C9H11N5O9S2/c1-3(22-24(16,17)18)6(23-25(19,20)21)4-2-11-7-5(12-4)8(15)14-9(10)13-7/h2-3,6H,1H3,(H,16,17,18)(H,19,20,21)(H3,10,11,13,14,15)/t3-,6-/m0/s1 |
| InChIKey | IDPNOXFZJYIENF-DZSWIPIPSA-N |
| XLogP | -1.64 |
| TPSA | 224.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|