About 2-amino-3H-pteridin-4-one;methanamine
2-amino-3H-pteridin-4-one;methanamine (PubChem CID 146301753) has the molecular formula C7H10N6O
and a molecular weight of 194.20 g/mol. Its IUPAC name is 2-amino-3H-pteridin-4-one;methanamine.
Molecular Properties
| Compound Name | 2-amino-3H-pteridin-4-one;methanamine |
| PubChem CID | 146301753 |
| Molecular Formula | C7H10N6O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-amino-3H-pteridin-4-one;methanamine |
| SMILES | CN.Nc1nc2nccnc2c(=O)[nH]1 |
| InChI | InChI=1S/C6H5N5O.CH5N/c7-6-10-4-3(5(12)11-6)8-1-2-9-4;1-2/h1-2H,(H3,7,9,10,11,12);2H2,1H3 |
| InChIKey | TXNGXYTWARUBOP-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-3H-pteridin-4-one;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3H-pteridin-4-one;methanamine?
The IUPAC name of 2-amino-3H-pteridin-4-one;methanamine (CID 146301753) is 2-amino-3H-pteridin-4-one;methanamine.
What is the SMILES notation for 2-amino-3H-pteridin-4-one;methanamine?
The canonical SMILES for 2-amino-3H-pteridin-4-one;methanamine is CN.Nc1nc2nccnc2c(=O)[nH]1.
What is the InChIKey of 2-amino-3H-pteridin-4-one;methanamine?
The InChIKey is TXNGXYTWARUBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5O.CH5N/c7-6-10-4-3(5(12)11-6)8-1-2-9-4;1-2/h1-2H,(H3,7,9,10,11,12);2H2,1H3.
What are the key properties of 2-amino-3H-pteridin-4-one;methanamine?
2-amino-3H-pteridin-4-one;methanamine has a molecular weight of 194.20 g/mol, XLogP of -1.13, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3H-pteridin-4-one;methanamine is sourced from PubChem (CID 146301753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).