C8H5N7O3 — CID 135414250
8-amino-1,7-dihydropyrimido[5,4-g]pteridine-2,4,6-trione (PubChem CID 135414250) has the molecular formula C8H5N7O3 and a molecular weight of 247.17 g/mol. Its IUPAC name is 8-amino-1,7-dihydropyrimido[5,4-g]pteridine-2,4,6-trione.
| Compound Name | 8-amino-1,7-dihydropyrimido[5,4-g]pteridine-2,4,6-trione |
|---|---|
| PubChem CID | 135414250 |
| Molecular Formula | C8H5N7O3 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 8-amino-1,7-dihydropyrimido[5,4-g]pteridine-2,4,6-trione |
| SMILES | Nc1nc2nc3[nH]c(=O)[nH]c(=O)c3nc2c(=O)[nH]1 |
| InChI | InChI=1S/C8H5N7O3/c9-7-12-3-1(5(16)14-7)10-2-4(11-3)13-8(18)15-6(2)17/h(H5,9,11,12,13,14,15,16,17,18) |
| InChIKey | BFBJBFGVPKEJFI-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 163.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|