About 2-amino-3H-pteridin-4-one;azane
2-amino-3H-pteridin-4-one;azane (PubChem CID 174295951) has the molecular formula C6H8N6O
and a molecular weight of 180.17 g/mol. Its IUPAC name is 2-amino-3H-pteridin-4-one;azane.
Molecular Properties
| Compound Name | 2-amino-3H-pteridin-4-one;azane |
| PubChem CID | 174295951 |
| Molecular Formula | C6H8N6O |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-amino-3H-pteridin-4-one;azane |
| SMILES | N.Nc1nc2nccnc2c(=O)[nH]1 |
| InChI | InChI=1S/C6H5N5O.H3N/c7-6-10-4-3(5(12)11-6)8-1-2-9-4;/h1-2H,(H3,7,9,10,11,12);1H3 |
| InChIKey | HRYHBCLVLFLOAU-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-3H-pteridin-4-one;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3H-pteridin-4-one;azane?
The IUPAC name of 2-amino-3H-pteridin-4-one;azane (CID 174295951) is 2-amino-3H-pteridin-4-one;azane.
What is the SMILES notation for 2-amino-3H-pteridin-4-one;azane?
The canonical SMILES for 2-amino-3H-pteridin-4-one;azane is N.Nc1nc2nccnc2c(=O)[nH]1.
What is the InChIKey of 2-amino-3H-pteridin-4-one;azane?
The InChIKey is HRYHBCLVLFLOAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5O.H3N/c7-6-10-4-3(5(12)11-6)8-1-2-9-4;/h1-2H,(H3,7,9,10,11,12);1H3.
What are the key properties of 2-amino-3H-pteridin-4-one;azane?
2-amino-3H-pteridin-4-one;azane has a molecular weight of 180.17 g/mol, XLogP of -0.54, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3H-pteridin-4-one;azane is sourced from PubChem (CID 174295951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).