C9H11N5O — CID 141118544
2-(propylamino)-3H-pteridin-4-one (PubChem CID 141118544) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-(propylamino)-3H-pteridin-4-one.
| Compound Name | 2-(propylamino)-3H-pteridin-4-one |
|---|---|
| PubChem CID | 141118544 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 2-(propylamino)-3H-pteridin-4-one |
| SMILES | CCCNc1nc2nccnc2c(=O)[nH]1 |
| InChI | InChI=1S/C9H11N5O/c1-2-3-12-9-13-7-6(8(15)14-9)10-4-5-11-7/h4-5H,2-3H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | ACZBZNLWWWXOBE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |