C10H13N3OS — CID 103331625
6-methyl-2-(propylamino)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 103331625) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 6-methyl-2-(propylamino)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-methyl-2-(propylamino)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 103331625 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 6-methyl-2-(propylamino)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCNc1nc2sc(C)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H13N3OS/c1-3-4-11-10-12-8(14)7-5-6(2)15-9(7)13-10/h5H,3-4H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | PZCSIPPKTXYMIF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |