C10H12ClN3S — CID 82309354
4-chloro-6-methyl-N-propylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 82309354) has the molecular formula C10H12ClN3S and a molecular weight of 241.75 g/mol. Its IUPAC name is 4-chloro-6-methyl-N-propylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-methyl-N-propylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 82309354 |
| Molecular Formula | C10H12ClN3S |
| Molecular Weight | 241.75 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 4-chloro-6-methyl-N-propylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCCNc1nc(Cl)c2cc(C)sc2n1 |
| InChI | InChI=1S/C10H12ClN3S/c1-3-4-12-10-13-8(11)7-5-6(2)15-9(7)14-10/h5H,3-4H2,1-2H3,(H,12,13,14) |
| InChIKey | VOAOFRVPODZEDV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |