C13H20N4S2 — CID 103328024
6-methyl-4-N-(2-methylsulfanylethyl)-2-N-propylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103328024) has the molecular formula C13H20N4S2 and a molecular weight of 296.47 g/mol. Its IUPAC name is 6-methyl-4-N-(2-methylsulfanylethyl)-2-N-propylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-(2-methylsulfanylethyl)-2-N-propylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103328024 |
| Molecular Formula | C13H20N4S2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 6-methyl-4-N-(2-methylsulfanylethyl)-2-N-propylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(NCCSC)c2cc(C)sc2n1 |
| InChI | InChI=1S/C13H20N4S2/c1-4-5-15-13-16-11(14-6-7-18-3)10-8-9(2)19-12(10)17-13/h8H,4-7H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | CNOUFCIUAUQNCO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|